About cobalt;bis(naphthalene-1,2,4-trione)
cobalt;bis(naphthalene-1,2,4-trione) (PubChem CID 70554472) has the molecular formula C20H12CoO6
and a molecular weight of 407.24 g/mol. Its IUPAC name is cobalt;bis(naphthalene-1,2,4-trione).
Molecular Properties
| Compound Name | cobalt;bis(naphthalene-1,2,4-trione) |
| PubChem CID | 70554472 |
| Molecular Formula | C20H12CoO6 |
| Molecular Weight | 407.24 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | cobalt;bis(naphthalene-1,2,4-trione) |
| SMILES | O=C1CC(=O)c2ccccc2C1=O.O=C1CC(=O)c2ccccc2C1=O.[Co] |
| InChI | InChI=1S/2C10H6O3.Co/c2*11-8-5-9(12)10(13)7-4-2-1-3-6(7)8;/h2*1-4H,5H2; |
| InChIKey | UGMARDCGRRPFON-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(naphthalene-1,2,4-trione) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(naphthalene-1,2,4-trione)?
The IUPAC name of cobalt;bis(naphthalene-1,2,4-trione) (CID 70554472) is cobalt;bis(naphthalene-1,2,4-trione).
What is the SMILES notation for cobalt;bis(naphthalene-1,2,4-trione)?
The canonical SMILES for cobalt;bis(naphthalene-1,2,4-trione) is O=C1CC(=O)c2ccccc2C1=O.O=C1CC(=O)c2ccccc2C1=O.[Co].
What is the InChIKey of cobalt;bis(naphthalene-1,2,4-trione)?
The InChIKey is UGMARDCGRRPFON-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H6O3.Co/c2*11-8-5-9(12)10(13)7-4-2-1-3-6(7)8;/h2*1-4H,5H2;.
What are the key properties of cobalt;bis(naphthalene-1,2,4-trione)?
cobalt;bis(naphthalene-1,2,4-trione) has a molecular weight of 407.24 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(naphthalene-1,2,4-trione) is sourced from PubChem (CID 70554472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).