C13H18ClN5O8S — CID 70554586
3-[[2-chloro-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 70554586) has the molecular formula C13H18ClN5O8S and a molecular weight of 439.83 g/mol. Its IUPAC name is 3-[[2-chloro-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[2-chloro-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 70554586 |
| Molecular Formula | C13H18ClN5O8S |
| Molecular Weight | 439.83 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 3-[[2-chloro-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CCN1CCN(C(=O)NC(C)(Cl)C(=O)NC2CN(S(=O)(=O)O)C2=O)C(=O)C1=O |
| InChI | InChI=1S/C13H18ClN5O8S/c1-3-17-4-5-18(10(22)9(17)21)12(24)16-13(2,14)11(23)15-7-6-19(8(7)20)28(25,26)27/h7H,3-6H2,1-2H3,(H,15,23)(H,16,24)(H,25,26,27) |
| InChIKey | MIQZKBDRCPJTAM-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.83 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|