About 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine
9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine (PubChem CID 70554801) has the molecular formula C20H15ClFN3O
and a molecular weight of 367.81 g/mol. Its IUPAC name is 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine.
Molecular Properties
| Compound Name | 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine |
| PubChem CID | 70554801 |
| Molecular Formula | C20H15ClFN3O |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine |
| SMILES | COC1N=C(c2ccccc2F)c2cc(Cl)ccc2-c2cnc(C)nc21 |
| InChI | InChI=1S/C20H15ClFN3O/c1-11-23-10-16-13-8-7-12(21)9-15(13)18(14-5-3-4-6-17(14)22)25-20(26-2)19(16)24-11/h3-10,20H,1-2H3 |
| InChIKey | QMBUSUXJWDIDNI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine?
The IUPAC name of 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine (CID 70554801) is 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine.
What is the SMILES notation for 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine?
The canonical SMILES for 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine is COC1N=C(c2ccccc2F)c2cc(Cl)ccc2-c2cnc(C)nc21.
What is the InChIKey of 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine?
The InChIKey is QMBUSUXJWDIDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClFN3O/c1-11-23-10-16-13-8-7-12(21)9-15(13)18(14-5-3-4-6-17(14)22)25-20(26-2)19(16)24-11/h3-10,20H,1-2H3.
What are the key properties of 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine?
9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine has a molecular weight of 367.81 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-7-(2-fluorophenyl)-5-methoxy-3-methyl-5H-pyrimido[4,5-d][2]benzazepine is sourced from PubChem (CID 70554801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).