About 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile
5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile (PubChem CID 70554825) has the molecular formula C9H10N4O3
and a molecular weight of 222.20 g/mol. Its IUPAC name is 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile |
| PubChem CID | 70554825 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile |
| SMILES | Cc1noc(N2C(=O)NCC2(C)O)c1C#N |
| InChI | InChI=1S/C9H10N4O3/c1-5-6(3-10)7(16-12-5)13-8(14)11-4-9(13,2)15/h15H,4H2,1-2H3,(H,11,14) |
| InChIKey | RAESQDCMWUFECT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile?
The IUPAC name of 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile (CID 70554825) is 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile.
What is the SMILES notation for 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile?
The canonical SMILES for 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile is Cc1noc(N2C(=O)NCC2(C)O)c1C#N.
What is the InChIKey of 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile?
The InChIKey is RAESQDCMWUFECT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O3/c1-5-6(3-10)7(16-12-5)13-8(14)11-4-9(13,2)15/h15H,4H2,1-2H3,(H,11,14).
What are the key properties of 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile?
5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile has a molecular weight of 222.20 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-hydroxy-5-methyl-2-oxoimidazolidin-1-yl)-3-methyl-1,2-oxazole-4-carbonitrile is sourced from PubChem (CID 70554825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).