C30H28N4O2 — CID 70554930
1,5-bis[N-(dimethylamino)anilino]anthracene-9,10-dione (PubChem CID 70554930) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 1,5-bis[N-(dimethylamino)anilino]anthracene-9,10-dione.
| Compound Name | 1,5-bis[N-(dimethylamino)anilino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 70554930 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 1,5-bis[N-(dimethylamino)anilino]anthracene-9,10-dione |
| SMILES | CN(C)N(c1ccccc1)c1cccc2c1C(=O)c1cccc(N(c3ccccc3)N(C)C)c1C2=O |
| InChI | InChI=1S/C30H28N4O2/c1-31(2)33(21-13-7-5-8-14-21)25-19-11-17-23-27(25)29(35)24-18-12-20-26(28(24)30(23)36)34(32(3)4)22-15-9-6-10-16-22/h5-20H,1-4H3 |
| InChIKey | BQFIVXKPYBMWCO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|