About N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine
N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 70555213) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 70555213 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C=CCN(CCCCC)C1=NCCN1 |
| InChI | InChI=1S/C11H21N3/c1-3-5-6-10-14(9-4-2)11-12-7-8-13-11/h4H,2-3,5-10H2,1H3,(H,12,13) |
| InChIKey | IODYHMMTACQMBJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine (CID 70555213) is N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine is C=CCN(CCCCC)C1=NCCN1.
What is the InChIKey of N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is IODYHMMTACQMBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-3-5-6-10-14(9-4-2)11-12-7-8-13-11/h4H,2-3,5-10H2,1H3,(H,12,13).
What are the key properties of N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine?
N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 195.31 g/mol, XLogP of 1.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentyl-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 70555213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).