About 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride
1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride (PubChem CID 70555479) has the molecular formula C12H16Cl2N2
and a molecular weight of 259.18 g/mol. Its IUPAC name is 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride |
| PubChem CID | 70555479 |
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride |
| SMILES | Cc1cc2ccc(N)cc2c(C)c1N.Cl.Cl |
| InChI | InChI=1S/C12H14N2.2ClH/c1-7-5-9-3-4-10(13)6-11(9)8(2)12(7)14;;/h3-6H,13-14H2,1-2H3;2*1H |
| InChIKey | IXGUDTVCCJVXBN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride?
The IUPAC name of 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride (CID 70555479) is 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride.
What is the SMILES notation for 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride?
The canonical SMILES for 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride is Cc1cc2ccc(N)cc2c(C)c1N.Cl.Cl.
What is the InChIKey of 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride?
The InChIKey is IXGUDTVCCJVXBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2.2ClH/c1-7-5-9-3-4-10(13)6-11(9)8(2)12(7)14;;/h3-6H,13-14H2,1-2H3;2*1H.
What are the key properties of 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride?
1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride has a molecular weight of 259.18 g/mol, XLogP of 3.46, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylnaphthalene-2,7-diamine;dihydrochloride is sourced from PubChem (CID 70555479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).