About 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea
3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea (PubChem CID 70555654) has the molecular formula C11H16N4O4
and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea.
Molecular Properties
| Compound Name | 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea |
| PubChem CID | 70555654 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea |
| SMILES | COC(CN(C)C(=O)Nc1onc(C)c1C#N)OC |
| InChI | InChI=1S/C11H16N4O4/c1-7-8(5-12)10(19-14-7)13-11(16)15(2)6-9(17-3)18-4/h9H,6H2,1-4H3,(H,13,16) |
| InChIKey | YUALBHUEABVGDG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea?
The IUPAC name of 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea (CID 70555654) is 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea.
What is the SMILES notation for 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea?
The canonical SMILES for 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea is COC(CN(C)C(=O)Nc1onc(C)c1C#N)OC.
What is the InChIKey of 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea?
The InChIKey is YUALBHUEABVGDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O4/c1-7-8(5-12)10(19-14-7)13-11(16)15(2)6-9(17-3)18-4/h9H,6H2,1-4H3,(H,13,16).
What are the key properties of 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea?
3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea has a molecular weight of 268.27 g/mol, XLogP of 0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-cyano-3-methyl-1,2-oxazol-5-yl)-1-(2,2-dimethoxyethyl)-1-methylurea is sourced from PubChem (CID 70555654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).