About 1,3-dibromobenzene;1,4-dibromobenzene
1,3-dibromobenzene;1,4-dibromobenzene (PubChem CID 70555684) has the molecular formula C12H8Br4
and a molecular weight of 471.81 g/mol. Its IUPAC name is 1,3-dibromobenzene;1,4-dibromobenzene.
Molecular Properties
| Compound Name | 1,3-dibromobenzene;1,4-dibromobenzene |
| PubChem CID | 70555684 |
| Molecular Formula | C12H8Br4 |
| Molecular Weight | 471.81 g/mol |
| Exact Mass | 467.74 |
| IUPAC Name | 1,3-dibromobenzene;1,4-dibromobenzene |
| SMILES | Brc1ccc(Br)cc1.Brc1cccc(Br)c1 |
| InChI | InChI=1S/2C6H4Br2/c7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5/h2*1-4H |
| InChIKey | AFJACOGHUNNDJR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.81 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dibromobenzene;1,4-dibromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromobenzene;1,4-dibromobenzene?
The IUPAC name of 1,3-dibromobenzene;1,4-dibromobenzene (CID 70555684) is 1,3-dibromobenzene;1,4-dibromobenzene.
What is the SMILES notation for 1,3-dibromobenzene;1,4-dibromobenzene?
The canonical SMILES for 1,3-dibromobenzene;1,4-dibromobenzene is Brc1ccc(Br)cc1.Brc1cccc(Br)c1.
What is the InChIKey of 1,3-dibromobenzene;1,4-dibromobenzene?
The InChIKey is AFJACOGHUNNDJR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H4Br2/c7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5/h2*1-4H.
What are the key properties of 1,3-dibromobenzene;1,4-dibromobenzene?
1,3-dibromobenzene;1,4-dibromobenzene has a molecular weight of 471.81 g/mol, XLogP of 6.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromobenzene;1,4-dibromobenzene is sourced from PubChem (CID 70555684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).