About carbamic acid;2-methylaniline
carbamic acid;2-methylaniline (PubChem CID 70556029) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is carbamic acid;2-methylaniline.
Molecular Properties
| Compound Name | carbamic acid;2-methylaniline |
| PubChem CID | 70556029 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | carbamic acid;2-methylaniline |
| SMILES | Cc1ccccc1N.NC(=O)O |
| InChI | InChI=1S/C7H9N.CH3NO2/c1-6-4-2-3-5-7(6)8;2-1(3)4/h2-5H,8H2,1H3;2H2,(H,3,4) |
| InChIKey | MRRGUONLNZUWET-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;2-methylaniline?
The IUPAC name of carbamic acid;2-methylaniline (CID 70556029) is carbamic acid;2-methylaniline.
What is the SMILES notation for carbamic acid;2-methylaniline?
The canonical SMILES for carbamic acid;2-methylaniline is Cc1ccccc1N.NC(=O)O.
What is the InChIKey of carbamic acid;2-methylaniline?
The InChIKey is MRRGUONLNZUWET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.CH3NO2/c1-6-4-2-3-5-7(6)8;2-1(3)4/h2-5H,8H2,1H3;2H2,(H,3,4).
What are the key properties of carbamic acid;2-methylaniline?
carbamic acid;2-methylaniline has a molecular weight of 168.20 g/mol, XLogP of 1.20, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;2-methylaniline is sourced from PubChem (CID 70556029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).