About (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one
(3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one (PubChem CID 7055608) has the molecular formula C17H14O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one.
Molecular Properties
| Compound Name | (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one |
| PubChem CID | 7055608 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one |
| SMILES | O=C1O/C=C\[C@@H](c2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C17H14O2/c18-17-16-9-5-4-8-15(16)12-14(10-11-19-17)13-6-2-1-3-7-13/h1-11,14H,12H2/b11-10-/t14-/m1/s1 |
| InChIKey | LPQMUKNRTNHKEO-IWMPZKFUSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one?
The IUPAC name of (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one (CID 7055608) is (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one.
What is the SMILES notation for (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one?
The canonical SMILES for (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one is O=C1O/C=C\[C@@H](c2ccccc2)Cc2ccccc21.
What is the InChIKey of (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one?
The InChIKey is LPQMUKNRTNHKEO-IWMPZKFUSA-N. The full InChI is InChI=1S/C17H14O2/c18-17-16-9-5-4-8-15(16)12-14(10-11-19-17)13-6-2-1-3-7-13/h1-11,14H,12H2/b11-10-/t14-/m1/s1.
What are the key properties of (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one?
(3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one has a molecular weight of 250.30 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5S)-5-phenyl-5,6-dihydro-2-benzoxocin-1-one is sourced from PubChem (CID 7055608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).