About 4H-4-benzazonin-9-ol
4H-4-benzazonin-9-ol (PubChem CID 70556222) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 4H-4-benzazonin-9-ol.
Molecular Properties
| Compound Name | 4H-4-benzazonin-9-ol |
| PubChem CID | 70556222 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4H-4-benzazonin-9-ol |
| SMILES | Oc1ccc2ccc[nH]cccc2c1 |
| InChI | InChI=1S/C12H11NO/c14-12-6-5-10-3-1-7-13-8-2-4-11(10)9-12/h1-9,13-14H/b7-1-,8-2-,10-3-,11-4- |
| InChIKey | FUPVYIDKMOOGDS-ACOIVEAWSA-N |
| XLogP | 3.00 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4H-4-benzazonin-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-4-benzazonin-9-ol?
The IUPAC name of 4H-4-benzazonin-9-ol (CID 70556222) is 4H-4-benzazonin-9-ol.
What is the SMILES notation for 4H-4-benzazonin-9-ol?
The canonical SMILES for 4H-4-benzazonin-9-ol is Oc1ccc2ccc[nH]cccc2c1.
What is the InChIKey of 4H-4-benzazonin-9-ol?
The InChIKey is FUPVYIDKMOOGDS-ACOIVEAWSA-N. The full InChI is InChI=1S/C12H11NO/c14-12-6-5-10-3-1-7-13-8-2-4-11(10)9-12/h1-9,13-14H/b7-1-,8-2-,10-3-,11-4-.
What are the key properties of 4H-4-benzazonin-9-ol?
4H-4-benzazonin-9-ol has a molecular weight of 185.23 g/mol, XLogP of 3.00, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-4-benzazonin-9-ol is sourced from PubChem (CID 70556222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).