C22H31FO3 — CID 70556333
(8S,9S,10R,13S,14S,17S)-6-fluoro-17-(2-hydroxyacetyl)-10,13,16-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70556333) has the molecular formula C22H31FO3 and a molecular weight of 362.49 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-6-fluoro-17-(2-hydroxyacetyl)-10,13,16-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-6-fluoro-17-(2-hydroxyacetyl)-10,13,16-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70556333 |
| Molecular Formula | C22H31FO3 |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-6-fluoro-17-(2-hydroxyacetyl)-10,13,16-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1C[C@H]2[C@@H]3CC(F)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]2(C)[C@H]1C(=O)CO |
| InChI | InChI=1S/C22H31FO3/c1-12-8-16-14-10-18(23)17-9-13(25)4-6-21(17,2)15(14)5-7-22(16,3)20(12)19(26)11-24/h9,12,14-16,18,20,24H,4-8,10-11H2,1-3H3/t12?,14-,15+,16+,18?,20-,21-,22+/m1/s1 |
| InChIKey | RMJVMCMOQFLXFN-KJCFVPGGSA-N |
| XLogP | 3.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |