C15H19Cl3O5 — CID 70556337
2-hydroxy-3,4-di(propan-2-yl)benzoic acid;2,2,2-trichloroacetic acid (PubChem CID 70556337) has the molecular formula C15H19Cl3O5 and a molecular weight of 385.67 g/mol. Its IUPAC name is 2-hydroxy-3,4-di(propan-2-yl)benzoic acid;2,2,2-trichloroacetic acid.
| Compound Name | 2-hydroxy-3,4-di(propan-2-yl)benzoic acid;2,2,2-trichloroacetic acid |
|---|---|
| PubChem CID | 70556337 |
| Molecular Formula | C15H19Cl3O5 |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-hydroxy-3,4-di(propan-2-yl)benzoic acid;2,2,2-trichloroacetic acid |
| SMILES | CC(C)c1ccc(C(=O)O)c(O)c1C(C)C.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H18O3.C2HCl3O2/c1-7(2)9-5-6-10(13(15)16)12(14)11(9)8(3)4;3-2(4,5)1(6)7/h5-8,14H,1-4H3,(H,15,16);(H,6,7) |
| InChIKey | ZDWTVQNWHFNONV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|