C21H31NO12 — CID 70556593
2,2-bis(hydroxymethyl)propane-1,3-diol;phenyl carbamate;tris(prop-2-enoic acid) (PubChem CID 70556593) has the molecular formula C21H31NO12 and a molecular weight of 489.47 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;phenyl carbamate;tris(prop-2-enoic acid).
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;phenyl carbamate;tris(prop-2-enoic acid) |
|---|---|
| PubChem CID | 70556593 |
| Molecular Formula | C21H31NO12 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;phenyl carbamate;tris(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.NC(=O)Oc1ccccc1.OCC(CO)(CO)CO |
| InChI | InChI=1S/C7H7NO2.C5H12O4.3C3H4O2/c8-7(9)10-6-4-2-1-3-5-6;6-1-5(2-7,3-8)4-9;3*1-2-3(4)5/h1-5H,(H2,8,9);6-9H,1-4H2;3*2H,1H2,(H,4,5) |
| InChIKey | FNZQOXZMSKJBDW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 245.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|