C27H44O8 — CID 70556941
[(3R)-3-[(3R,5R,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-methoxycarbonyloxybutyl] methyl carbonate (PubChem CID 70556941) has the molecular formula C27H44O8 and a molecular weight of 496.64 g/mol. Its IUPAC name is [(3R)-3-[(3R,5R,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-methoxycarbonyloxybutyl] methyl carbonate.
| Compound Name | [(3R)-3-[(3R,5R,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-methoxycarbonyloxybutyl] methyl carbonate |
|---|---|
| PubChem CID | 70556941 |
| Molecular Formula | C27H44O8 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | [(3R)-3-[(3R,5R,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-methoxycarbonyloxybutyl] methyl carbonate |
| SMILES | COC(=O)OC(C[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)OC(=O)OC |
| InChI | InChI=1S/C27H44O8/c1-15(12-22(34-24(30)32-4)35-25(31)33-5)18-6-7-19-23-20(9-11-27(18,19)3)26(2)10-8-17(28)13-16(26)14-21(23)29/h15-23,28-29H,6-14H2,1-5H3/t15-,16-,17-,18-,19+,20+,21-,23+,26+,27-/m1/s1 |
| InChIKey | RFOHUFPDXBINMQ-ZWHRYOBBSA-N |
| XLogP | 4.90 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|