C9H13NS — CID 70557525
2,3,4,5,6,7-hexahydrothiopyrano[3,2-b]azepine (PubChem CID 70557525) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexahydrothiopyrano[3,2-b]azepine.
| Compound Name | 2,3,4,5,6,7-hexahydrothiopyrano[3,2-b]azepine |
|---|---|
| PubChem CID | 70557525 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2,3,4,5,6,7-hexahydrothiopyrano[3,2-b]azepine |
| SMILES | C1=CC2=C(CCCS2)NCC1 |
| InChI | InChI=1S/C9H13NS/c1-2-6-10-8-4-3-7-11-9(8)5-1/h1,5,10H,2-4,6-7H2 |
| InChIKey | KFKYHYFFQRYKCJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |