About 4H-5,1-benzothiazocine
4H-5,1-benzothiazocine (PubChem CID 70557698) has the molecular formula C10H9NS
and a molecular weight of 175.26 g/mol. Its IUPAC name is 4H-5,1-benzothiazocine.
Molecular Properties
| Compound Name | 4H-5,1-benzothiazocine |
| PubChem CID | 70557698 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 4H-5,1-benzothiazocine |
| SMILES | C1=C/N=c2/ccccc2=CSC1 |
| InChI | InChI=1S/C10H9NS/c1-2-5-10-9(4-1)8-12-7-3-6-11-10/h1-6,8H,7H2/b6-3?,9-8?,11-10- |
| InChIKey | KKSGOBLPDRFILD-HDKFRDGXSA-N |
| XLogP | 1.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-5,1-benzothiazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-5,1-benzothiazocine?
The IUPAC name of 4H-5,1-benzothiazocine (CID 70557698) is 4H-5,1-benzothiazocine.
What is the SMILES notation for 4H-5,1-benzothiazocine?
The canonical SMILES for 4H-5,1-benzothiazocine is C1=C/N=c2/ccccc2=CSC1.
What is the InChIKey of 4H-5,1-benzothiazocine?
The InChIKey is KKSGOBLPDRFILD-HDKFRDGXSA-N. The full InChI is InChI=1S/C10H9NS/c1-2-5-10-9(4-1)8-12-7-3-6-11-10/h1-6,8H,7H2/b6-3?,9-8?,11-10-.
What are the key properties of 4H-5,1-benzothiazocine?
4H-5,1-benzothiazocine has a molecular weight of 175.26 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-5,1-benzothiazocine is sourced from PubChem (CID 70557698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).