About (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol
(7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol (PubChem CID 7055773) has the molecular formula C16H11FO
and a molecular weight of 238.26 g/mol. Its IUPAC name is (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol.
Molecular Properties
| Compound Name | (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
| PubChem CID | 7055773 |
| Molecular Formula | C16H11FO |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
| SMILES | O[C@@]1(C#Cc2ccccc2)Cc2cccc(F)c21 |
| InChI | InChI=1S/C16H11FO/c17-14-8-4-7-13-11-16(18,15(13)14)10-9-12-5-2-1-3-6-12/h1-8,18H,11H2/t16-/m0/s1 |
| InChIKey | YZJKRVNAWTYIJU-INIZCTEOSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol?
The IUPAC name of (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol (CID 7055773) is (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol.
What is the SMILES notation for (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol?
The canonical SMILES for (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol is O[C@@]1(C#Cc2ccccc2)Cc2cccc(F)c21.
What is the InChIKey of (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol?
The InChIKey is YZJKRVNAWTYIJU-INIZCTEOSA-N. The full InChI is InChI=1S/C16H11FO/c17-14-8-4-7-13-11-16(18,15(13)14)10-9-12-5-2-1-3-6-12/h1-8,18H,11H2/t16-/m0/s1.
What are the key properties of (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol?
(7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol has a molecular weight of 238.26 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-5-fluoro-7-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-trien-7-ol is sourced from PubChem (CID 7055773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).