C17H23F3O3 — CID 70558011
(3aR,4R,5R,6aR)-5-methyl-4-[3-oxo-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70558011) has the molecular formula C17H23F3O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is (3aR,4R,5R,6aR)-5-methyl-4-[3-oxo-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aR)-5-methyl-4-[3-oxo-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70558011 |
| Molecular Formula | C17H23F3O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (3aR,4R,5R,6aR)-5-methyl-4-[3-oxo-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C(=O)C=C[C@@H]1[C@H]2CC(=O)O[C@@H]2C[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C17H23F3O3/c1-3-4-5-13(17(18,19)20)14(21)7-6-11-10(2)8-15-12(11)9-16(22)23-15/h6-7,10-13,15H,3-5,8-9H2,1-2H3/t10-,11+,12-,13?,15-/m1/s1 |
| InChIKey | HJXXXFBWJUIDCL-SNKAUFMGSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|