C27H45FO5 — CID 70558190
(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R,4R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid (PubChem CID 70558190) has the molecular formula C27H45FO5 and a molecular weight of 468.65 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R,4R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R,4R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70558190 |
| Molecular Formula | C27H45FO5 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R,4R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid |
| SMILES | CCCC[C@@](C)(F)[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1C)OC1CCCCO1 |
| InChI | InChI=1S/C27H45FO5/c1-4-5-17-27(3,28)24(33-26-14-10-11-18-32-26)16-15-21-20(2)19-23(29)22(21)12-8-6-7-9-13-25(30)31/h6,8,15-16,20-24,26,29H,4-5,7,9-14,17-19H2,1-3H3,(H,30,31)/b8-6-,16-15+/t20-,21+,22-,23+,24-,26?,27-/m1/s1 |
| InChIKey | JFUXWLUZSFXBLC-XMLZPXCRSA-N |
| XLogP | 6.21 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|