About 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol
4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol (PubChem CID 70558351) has the molecular formula C21H24O2
and a molecular weight of 308.42 g/mol. Its IUPAC name is 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol.
Molecular Properties
| Compound Name | 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol |
| PubChem CID | 70558351 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol |
| SMILES | Cc1cccc(C(C=CCO)C(O)C=CCc2ccccc2)c1 |
| InChI | InChI=1S/C21H24O2/c1-17-8-5-12-19(16-17)20(13-7-15-22)21(23)14-6-11-18-9-3-2-4-10-18/h2-10,12-14,16,20-23H,11,15H2,1H3 |
| InChIKey | RWKOPXHNEPFHDU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol?
The IUPAC name of 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol (CID 70558351) is 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol.
What is the SMILES notation for 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol?
The canonical SMILES for 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol is Cc1cccc(C(C=CCO)C(O)C=CCc2ccccc2)c1.
What is the InChIKey of 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol?
The InChIKey is RWKOPXHNEPFHDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O2/c1-17-8-5-12-19(16-17)20(13-7-15-22)21(23)14-6-11-18-9-3-2-4-10-18/h2-10,12-14,16,20-23H,11,15H2,1H3.
What are the key properties of 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol?
4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol has a molecular weight of 308.42 g/mol, XLogP of 3.79, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylphenyl)-8-phenylocta-2,6-diene-1,5-diol is sourced from PubChem (CID 70558351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).