C16H21F3O3 — CID 70558463
(3aR,4R,6aR)-4-[3-oxo-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70558463) has the molecular formula C16H21F3O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is (3aR,4R,6aR)-4-[3-oxo-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aR)-4-[3-oxo-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70558463 |
| Molecular Formula | C16H21F3O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (3aR,4R,6aR)-4-[3-oxo-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C(=O)C=C[C@H]1CC[C@H]2OC(=O)C[C@H]12)C(F)(F)F |
| InChI | InChI=1S/C16H21F3O3/c1-2-3-4-12(16(17,18)19)13(20)7-5-10-6-8-14-11(10)9-15(21)22-14/h5,7,10-12,14H,2-4,6,8-9H2,1H3/t10-,11+,12?,14+/m0/s1 |
| InChIKey | CKFGRWOUUNIFMB-PPSDRIHMSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|