C16H23FO3 — CID 70558947
4-[(E)-4-fluoro-4-methyl-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70558947) has the molecular formula C16H23FO3 and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-[(E)-4-fluoro-4-methyl-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | 4-[(E)-4-fluoro-4-methyl-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70558947 |
| Molecular Formula | C16H23FO3 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-[(E)-4-fluoro-4-methyl-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(F)C(=O)/C=C/C1CCC2OC(=O)CC12 |
| InChI | InChI=1S/C16H23FO3/c1-3-4-9-16(2,17)14(18)8-6-11-5-7-13-12(11)10-15(19)20-13/h6,8,11-13H,3-5,7,9-10H2,1-2H3/b8-6+ |
| InChIKey | AZKDQRABNFZWLX-SOFGYWHQSA-N |
| XLogP | 3.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|