C13H14F3N3OS — CID 70559014
(4aS,5S,7aS)-7a-(5-amino-2,3-difluorophenyl)-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-amine (PubChem CID 70559014) has the molecular formula C13H14F3N3OS and a molecular weight of 317.34 g/mol. Its IUPAC name is (4aS,5S,7aS)-7a-(5-amino-2,3-difluorophenyl)-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-amine.
| Compound Name | (4aS,5S,7aS)-7a-(5-amino-2,3-difluorophenyl)-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 70559014 |
| Molecular Formula | C13H14F3N3OS |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (4aS,5S,7aS)-7a-(5-amino-2,3-difluorophenyl)-5-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-amine |
| SMILES | NC1=NC[C@H]2[C@@H](CF)OC[C@]2(c2cc(N)cc(F)c2F)S1 |
| InChI | InChI=1S/C13H14F3N3OS/c14-3-10-8-4-19-12(18)21-13(8,5-20-10)7-1-6(17)2-9(15)11(7)16/h1-2,8,10H,3-5,17H2,(H2,18,19)/t8-,10+,13+/m0/s1 |
| InChIKey | XVPWYADOKXBSOC-IYYTYJHQSA-N |
| XLogP | 1.79 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|