C23H31NO2 — CID 70559240
5-(4-cyanocyclohexyl)-6-pentyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 70559240) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 5-(4-cyanocyclohexyl)-6-pentyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 5-(4-cyanocyclohexyl)-6-pentyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 70559240 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 5-(4-cyanocyclohexyl)-6-pentyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | CCCCCC1CCc2cc(C(=O)O)ccc2C1C1CCC(C#N)CC1 |
| InChI | InChI=1S/C23H31NO2/c1-2-3-4-5-17-10-11-19-14-20(23(25)26)12-13-21(19)22(17)18-8-6-16(15-24)7-9-18/h12-14,16-18,22H,2-11H2,1H3,(H,25,26) |
| InChIKey | WJWGTJCZPDVVKX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|