About 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine
4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine (PubChem CID 70559432) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine.
Molecular Properties
| Compound Name | 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine |
| PubChem CID | 70559432 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine |
| SMILES | CC1=CC(C2CCN(C)C(C)C2)=CCN1C |
| InChI | InChI=1S/C14H24N2/c1-11-9-13(5-7-15(11)3)14-6-8-16(4)12(2)10-14/h5,9,12,14H,6-8,10H2,1-4H3 |
| InChIKey | MSXBWLADKAYBPS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine?
The IUPAC name of 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine (CID 70559432) is 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine.
What is the SMILES notation for 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine?
The canonical SMILES for 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine is CC1=CC(C2CCN(C)C(C)C2)=CCN1C.
What is the InChIKey of 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine?
The InChIKey is MSXBWLADKAYBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-11-9-13(5-7-15(11)3)14-6-8-16(4)12(2)10-14/h5,9,12,14H,6-8,10H2,1-4H3.
What are the key properties of 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine?
4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine has a molecular weight of 220.36 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-dimethylpiperidin-4-yl)-1,6-dimethyl-2H-pyridine is sourced from PubChem (CID 70559432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).