C10H16NO4+ — CID 7055966
2,2-dihydroxyethyl-[(3-hydroxy-4-methoxyphenyl)methyl]azanium (PubChem CID 7055966) has the molecular formula C10H16NO4+ and a molecular weight of 214.24 g/mol. Its IUPAC name is 2,2-dihydroxyethyl-[(3-hydroxy-4-methoxyphenyl)methyl]azanium.
| Compound Name | 2,2-dihydroxyethyl-[(3-hydroxy-4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7055966 |
| Molecular Formula | C10H16NO4+ |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2,2-dihydroxyethyl-[(3-hydroxy-4-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CC(O)O)cc1O |
| InChI | InChI=1S/C10H15NO4/c1-15-9-3-2-7(4-8(9)12)5-11-6-10(13)14/h2-4,10-14H,5-6H2,1H3/p+1 |
| InChIKey | XCMKAJLQZLXOQI-UHFFFAOYSA-O |
| XLogP | -1.23 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|