About bicyclo[2.2.2]octane-2,3,5,8-tetrone
bicyclo[2.2.2]octane-2,3,5,8-tetrone (PubChem CID 70559708) has the molecular formula C8H6O4
and a molecular weight of 166.13 g/mol. Its IUPAC name is bicyclo[2.2.2]octane-2,3,5,8-tetrone.
Molecular Properties
| Compound Name | bicyclo[2.2.2]octane-2,3,5,8-tetrone |
| PubChem CID | 70559708 |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | bicyclo[2.2.2]octane-2,3,5,8-tetrone |
| SMILES | O=C1C(=O)C2C(=O)CC1CC2=O |
| InChI | InChI=1S/C8H6O4/c9-4-1-3-2-5(10)6(4)8(12)7(3)11/h3,6H,1-2H2 |
| InChIKey | OFUXZOHIOXTIAZ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.2]octane-2,3,5,8-tetrone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.2]octane-2,3,5,8-tetrone?
The IUPAC name of bicyclo[2.2.2]octane-2,3,5,8-tetrone (CID 70559708) is bicyclo[2.2.2]octane-2,3,5,8-tetrone.
What is the SMILES notation for bicyclo[2.2.2]octane-2,3,5,8-tetrone?
The canonical SMILES for bicyclo[2.2.2]octane-2,3,5,8-tetrone is O=C1C(=O)C2C(=O)CC1CC2=O.
What is the InChIKey of bicyclo[2.2.2]octane-2,3,5,8-tetrone?
The InChIKey is OFUXZOHIOXTIAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4/c9-4-1-3-2-5(10)6(4)8(12)7(3)11/h3,6H,1-2H2.
What are the key properties of bicyclo[2.2.2]octane-2,3,5,8-tetrone?
bicyclo[2.2.2]octane-2,3,5,8-tetrone has a molecular weight of 166.13 g/mol, XLogP of -0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.2]octane-2,3,5,8-tetrone is sourced from PubChem (CID 70559708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).