About [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one
[3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one (PubChem CID 70559842) has the molecular formula C15H26N2O4
and a molecular weight of 298.38 g/mol. Its IUPAC name is [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one.
Molecular Properties
| Compound Name | [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one |
| PubChem CID | 70559842 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one |
| SMILES | C=C(C)C(=O)OCCC(=O)NCCCC.O=C1CCCN1 |
| InChI | InChI=1S/C11H19NO3.C4H7NO/c1-4-5-7-12-10(13)6-8-15-11(14)9(2)3;6-4-2-1-3-5-4/h2,4-8H2,1,3H3,(H,12,13);1-3H2,(H,5,6) |
| InChIKey | TUMSGPOWMIMWHY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one?
The IUPAC name of [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one (CID 70559842) is [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one.
What is the SMILES notation for [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one?
The canonical SMILES for [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one is C=C(C)C(=O)OCCC(=O)NCCCC.O=C1CCCN1.
What is the InChIKey of [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one?
The InChIKey is TUMSGPOWMIMWHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3.C4H7NO/c1-4-5-7-12-10(13)6-8-15-11(14)9(2)3;6-4-2-1-3-5-4/h2,4-8H2,1,3H3,(H,12,13);1-3H2,(H,5,6).
What are the key properties of [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one?
[3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one has a molecular weight of 298.38 g/mol, XLogP of 1.31, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(butylamino)-3-oxopropyl] 2-methylprop-2-enoate;pyrrolidin-2-one is sourced from PubChem (CID 70559842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).