C26H43FO5 — CID 70560516
(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R,4R)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid (PubChem CID 70560516) has the molecular formula C26H43FO5 and a molecular weight of 454.62 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R,4R)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R,4R)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70560516 |
| Molecular Formula | C26H43FO5 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R,4R)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid |
| SMILES | CCCC[C@@H](F)[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1C)OC1CCCCO1 |
| InChI | InChI=1S/C26H43FO5/c1-3-4-12-22(27)24(32-26-14-9-10-17-31-26)16-15-20-19(2)18-23(28)21(20)11-7-5-6-8-13-25(29)30/h5,7,15-16,19-24,26,28H,3-4,6,8-14,17-18H2,1-2H3,(H,29,30)/b7-5-,16-15+/t19-,20+,21-,22-,23+,24-,26?/m1/s1 |
| InChIKey | IVPGZQLGQXNBDF-SMANZSQASA-N |
| XLogP | 5.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|