About 5-methyl-1-sulfonyl-1,3-thiazol-2-amine
5-methyl-1-sulfonyl-1,3-thiazol-2-amine (PubChem CID 70561053) has the molecular formula C4H6N2O2S2
and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-methyl-1-sulfonyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-1-sulfonyl-1,3-thiazol-2-amine |
| PubChem CID | 70561053 |
| Molecular Formula | C4H6N2O2S2 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | 5-methyl-1-sulfonyl-1,3-thiazol-2-amine |
| SMILES | CC1=CN=C(N)S1=S(=O)=O |
| InChI | InChI=1S/C4H6N2O2S2/c1-3-2-6-4(5)9(3)10(7)8/h2H,1H3,(H2,5,6) |
| InChIKey | HZIXYHCBTSLZFP-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-1-sulfonyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-sulfonyl-1,3-thiazol-2-amine?
The IUPAC name of 5-methyl-1-sulfonyl-1,3-thiazol-2-amine (CID 70561053) is 5-methyl-1-sulfonyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-methyl-1-sulfonyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-methyl-1-sulfonyl-1,3-thiazol-2-amine is CC1=CN=C(N)S1=S(=O)=O.
What is the InChIKey of 5-methyl-1-sulfonyl-1,3-thiazol-2-amine?
The InChIKey is HZIXYHCBTSLZFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2S2/c1-3-2-6-4(5)9(3)10(7)8/h2H,1H3,(H2,5,6).
What are the key properties of 5-methyl-1-sulfonyl-1,3-thiazol-2-amine?
5-methyl-1-sulfonyl-1,3-thiazol-2-amine has a molecular weight of 178.24 g/mol, XLogP of -0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-sulfonyl-1,3-thiazol-2-amine is sourced from PubChem (CID 70561053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).