About benzo[c]cinnoline;cinnoline
benzo[c]cinnoline;cinnoline (PubChem CID 70561425) has the molecular formula C20H14N4
and a molecular weight of 310.36 g/mol. Its IUPAC name is benzo[c]cinnoline;cinnoline.
Molecular Properties
| Compound Name | benzo[c]cinnoline;cinnoline |
| PubChem CID | 70561425 |
| Molecular Formula | C20H14N4 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | benzo[c]cinnoline;cinnoline |
| SMILES | c1ccc2c(c1)nnc1ccccc12.c1ccc2nnccc2c1 |
| InChI | InChI=1S/C12H8N2.C8H6N2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13-11;1-2-4-8-7(3-1)5-6-9-10-8/h1-8H;1-6H |
| InChIKey | DUDXRTIWHIGVAT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[c]cinnoline;cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[c]cinnoline;cinnoline?
The IUPAC name of benzo[c]cinnoline;cinnoline (CID 70561425) is benzo[c]cinnoline;cinnoline.
What is the SMILES notation for benzo[c]cinnoline;cinnoline?
The canonical SMILES for benzo[c]cinnoline;cinnoline is c1ccc2c(c1)nnc1ccccc12.c1ccc2nnccc2c1.
What is the InChIKey of benzo[c]cinnoline;cinnoline?
The InChIKey is DUDXRTIWHIGVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C8H6N2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13-11;1-2-4-8-7(3-1)5-6-9-10-8/h1-8H;1-6H.
What are the key properties of benzo[c]cinnoline;cinnoline?
benzo[c]cinnoline;cinnoline has a molecular weight of 310.36 g/mol, XLogP of 4.41, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[c]cinnoline;cinnoline is sourced from PubChem (CID 70561425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).