About bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate
bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate (PubChem CID 70561468) has the molecular formula C42H26Cl2O6
and a molecular weight of 697.57 g/mol. Its IUPAC name is bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate.
Molecular Properties
| Compound Name | bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate |
| PubChem CID | 70561468 |
| Molecular Formula | C42H26Cl2O6 |
| Molecular Weight | 697.57 g/mol |
| Exact Mass | 696.11 |
| IUPAC Name | bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate |
| SMILES | O=C(Oc1c(Cl)ccc2ccccc12)Oc1c(Cl)ccc2ccccc12.O=C(Oc1cccc2ccccc12)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C21H12Cl2O3.C21H14O3/c22-17-11-9-13-5-1-3-7-15(13)19(17)25-21(24)26-20-16-8-4-2-6-14(16)10-12-18(20)23;22-21(23-19-13-5-9-15-7-1-3-11-17(15)19)24-20-14-6-10-16-8-2-4-12-18(16)20/h1-12H;1-14H |
| InChIKey | DRVCLXHJFVELQB-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 697.57 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate?
The IUPAC name of bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate (CID 70561468) is bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate.
What is the SMILES notation for bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate?
The canonical SMILES for bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate is O=C(Oc1c(Cl)ccc2ccccc12)Oc1c(Cl)ccc2ccccc12.O=C(Oc1cccc2ccccc12)Oc1cccc2ccccc12.
What is the InChIKey of bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate?
The InChIKey is DRVCLXHJFVELQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12Cl2O3.C21H14O3/c22-17-11-9-13-5-1-3-7-15(13)19(17)25-21(24)26-20-16-8-4-2-6-14(16)10-12-18(20)23;22-21(23-19-13-5-9-15-7-1-3-11-17(15)19)24-20-14-6-10-16-8-2-4-12-18(16)20/h1-12H;1-14H.
What are the key properties of bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate?
bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate has a molecular weight of 697.57 g/mol, XLogP of 12.45, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-chloronaphthalen-1-yl) carbonate;dinaphthalen-1-yl carbonate is sourced from PubChem (CID 70561468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).