C8H10Br3FO2 — CID 70561550
2,2-dimethyl-3-(1,2,2-tribromo-2-fluoroethyl)cyclopropane-1-carboxylic acid (PubChem CID 70561550) has the molecular formula C8H10Br3FO2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 2,2-dimethyl-3-(1,2,2-tribromo-2-fluoroethyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-3-(1,2,2-tribromo-2-fluoroethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70561550 |
| Molecular Formula | C8H10Br3FO2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 393.82 |
| IUPAC Name | 2,2-dimethyl-3-(1,2,2-tribromo-2-fluoroethyl)cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C(=O)O)C1C(Br)C(F)(Br)Br |
| InChI | InChI=1S/C8H10Br3FO2/c1-7(2)3(4(7)6(13)14)5(9)8(10,11)12/h3-5H,1-2H3,(H,13,14) |
| InChIKey | JTCUFIRVGLWBMU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|