About ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate
ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate (PubChem CID 70561699) has the molecular formula C9H10ClNO2
and a molecular weight of 199.64 g/mol. Its IUPAC name is ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 70561699 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCC(=NCl)C=C1 |
| InChI | InChI=1S/C9H10ClNO2/c1-2-13-9(12)7-3-5-8(11-10)6-4-7/h3-5H,2,6H2,1H3 |
| InChIKey | HPQWQTOTNZQUAH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate (CID 70561699) is ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate is CCOC(=O)C1=CCC(=NCl)C=C1.
What is the InChIKey of ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate?
The InChIKey is HPQWQTOTNZQUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2/c1-2-13-9(12)7-3-5-8(11-10)6-4-7/h3-5H,2,6H2,1H3.
What are the key properties of ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate?
ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate has a molecular weight of 199.64 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloroiminocyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 70561699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).