C15H22INO — CID 70561868
1-iodo-5,5-dimethyl-3-(methylaminomethyl)-6,7,8,9-tetrahydrobenzo[7]annulen-2-ol (PubChem CID 70561868) has the molecular formula C15H22INO and a molecular weight of 359.25 g/mol. Its IUPAC name is 1-iodo-5,5-dimethyl-3-(methylaminomethyl)-6,7,8,9-tetrahydrobenzo[7]annulen-2-ol.
| Compound Name | 1-iodo-5,5-dimethyl-3-(methylaminomethyl)-6,7,8,9-tetrahydrobenzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 70561868 |
| Molecular Formula | C15H22INO |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 1-iodo-5,5-dimethyl-3-(methylaminomethyl)-6,7,8,9-tetrahydrobenzo[7]annulen-2-ol |
| SMILES | CNCc1cc2c(c(I)c1O)CCCCC2(C)C |
| InChI | InChI=1S/C15H22INO/c1-15(2)7-5-4-6-11-12(15)8-10(9-17-3)14(18)13(11)16/h8,17-18H,4-7,9H2,1-3H3 |
| InChIKey | PAATZGYVAXWXBZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|