About (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate
(2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate (PubChem CID 70561964) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate.
Molecular Properties
| Compound Name | (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate |
| PubChem CID | 70561964 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1C(CC)=CCCC1(C)C |
| InChI | InChI=1S/C14H22O3/c1-5-10-16-13(15)17-12-11(6-2)8-7-9-14(12,3)4/h5,8,12H,1,6-7,9-10H2,2-4H3 |
| InChIKey | RKPRUEPTSJWPDM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate?
The IUPAC name of (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate (CID 70561964) is (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate.
What is the SMILES notation for (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate?
The canonical SMILES for (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate is C=CCOC(=O)OC1C(CC)=CCCC1(C)C.
What is the InChIKey of (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate?
The InChIKey is RKPRUEPTSJWPDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-5-10-16-13(15)17-12-11(6-2)8-7-9-14(12,3)4/h5,8,12H,1,6-7,9-10H2,2-4H3.
What are the key properties of (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate?
(2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate has a molecular weight of 238.33 g/mol, XLogP of 3.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-6,6-dimethylcyclohex-2-en-1-yl) prop-2-enyl carbonate is sourced from PubChem (CID 70561964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).