About N-(4-aminophenyl)-N,N'-dimethylethanimidamide
N-(4-aminophenyl)-N,N'-dimethylethanimidamide (PubChem CID 70562086) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is N-(4-aminophenyl)-N,N'-dimethylethanimidamide.
Molecular Properties
| Compound Name | N-(4-aminophenyl)-N,N'-dimethylethanimidamide |
| PubChem CID | 70562086 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-(4-aminophenyl)-N,N'-dimethylethanimidamide |
| SMILES | C/N=C(\C)N(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H15N3/c1-8(12-2)13(3)10-6-4-9(11)5-7-10/h4-7H,11H2,1-3H3/b12-8+ |
| InChIKey | JSLBOTJXEBXJHC-XYOKQWHBSA-N |
| XLogP | 1.75 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminophenyl)-N,N'-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminophenyl)-N,N'-dimethylethanimidamide?
The IUPAC name of N-(4-aminophenyl)-N,N'-dimethylethanimidamide (CID 70562086) is N-(4-aminophenyl)-N,N'-dimethylethanimidamide.
What is the SMILES notation for N-(4-aminophenyl)-N,N'-dimethylethanimidamide?
The canonical SMILES for N-(4-aminophenyl)-N,N'-dimethylethanimidamide is C/N=C(\C)N(C)c1ccc(N)cc1.
What is the InChIKey of N-(4-aminophenyl)-N,N'-dimethylethanimidamide?
The InChIKey is JSLBOTJXEBXJHC-XYOKQWHBSA-N. The full InChI is InChI=1S/C10H15N3/c1-8(12-2)13(3)10-6-4-9(11)5-7-10/h4-7H,11H2,1-3H3/b12-8+.
What are the key properties of N-(4-aminophenyl)-N,N'-dimethylethanimidamide?
N-(4-aminophenyl)-N,N'-dimethylethanimidamide has a molecular weight of 177.25 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminophenyl)-N,N'-dimethylethanimidamide is sourced from PubChem (CID 70562086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).