About 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride
5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride (PubChem CID 70562248) has the molecular formula C15H28Cl2N2
and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride.
Molecular Properties
| Compound Name | 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride |
| PubChem CID | 70562248 |
| Molecular Formula | C15H28Cl2N2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride |
| SMILES | CCN(CC)c1cc(CCN)ccc1C(C)C.Cl.Cl |
| InChI | InChI=1S/C15H26N2.2ClH/c1-5-17(6-2)15-11-13(9-10-16)7-8-14(15)12(3)4;;/h7-8,11-12H,5-6,9-10,16H2,1-4H3;2*1H |
| InChIKey | UELJLBBBTISUAS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride?
The IUPAC name of 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride (CID 70562248) is 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride.
What is the SMILES notation for 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride?
The canonical SMILES for 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride is CCN(CC)c1cc(CCN)ccc1C(C)C.Cl.Cl.
What is the InChIKey of 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride?
The InChIKey is UELJLBBBTISUAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2.2ClH/c1-5-17(6-2)15-11-13(9-10-16)7-8-14(15)12(3)4;;/h7-8,11-12H,5-6,9-10,16H2,1-4H3;2*1H.
What are the key properties of 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride?
5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride has a molecular weight of 307.31 g/mol, XLogP of 4.00, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)-N,N-diethyl-2-propan-2-ylaniline;dihydrochloride is sourced from PubChem (CID 70562248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).