C18H19FN2O8 — CID 70562285
methyl (2S,3S,4S,5R,6S)-6-(5-fluoro-4-phenylmethoxypyrimidin-2-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 70562285) has the molecular formula C18H19FN2O8 and a molecular weight of 410.35 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-6-(5-fluoro-4-phenylmethoxypyrimidin-2-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-6-(5-fluoro-4-phenylmethoxypyrimidin-2-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 70562285 |
| Molecular Formula | C18H19FN2O8 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-6-(5-fluoro-4-phenylmethoxypyrimidin-2-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ncc(F)c(OCc3ccccc3)n2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19FN2O8/c1-26-16(25)14-12(23)11(22)13(24)17(28-14)29-18-20-7-10(19)15(21-18)27-8-9-5-3-2-4-6-9/h2-7,11-14,17,22-24H,8H2,1H3/t11-,12-,13+,14-,17-/m0/s1 |
| InChIKey | GUZQPXGNCQFRSP-LHLGERLTSA-N |
| XLogP | -0.45 |
| TPSA | 140.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |