C14H16ClNO — CID 7056305
(3aS,8aS)-3-(4-chlorophenyl)-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazole (PubChem CID 7056305) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is (3aS,8aS)-3-(4-chlorophenyl)-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazole.
| Compound Name | (3aS,8aS)-3-(4-chlorophenyl)-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazole |
|---|---|
| PubChem CID | 7056305 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (3aS,8aS)-3-(4-chlorophenyl)-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,2]oxazole |
| SMILES | Clc1ccc(C2=NO[C@H]3CCCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C14H16ClNO/c15-11-8-6-10(7-9-11)14-12-4-2-1-3-5-13(12)17-16-14/h6-9,12-13H,1-5H2/t12-,13+/m1/s1 |
| InChIKey | DVZFAPMNLBLVRC-OLZOCXBDSA-N |
| XLogP | 4.02 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |