C12H15IO — CID 70563119
4-iodo-2-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol (PubChem CID 70563119) has the molecular formula C12H15IO and a molecular weight of 302.16 g/mol. Its IUPAC name is 4-iodo-2-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol.
| Compound Name | 4-iodo-2-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol |
|---|---|
| PubChem CID | 70563119 |
| Molecular Formula | C12H15IO |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-iodo-2-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ol |
| SMILES | Cc1cc2c(c(I)c1O)CCCCC2 |
| InChI | InChI=1S/C12H15IO/c1-8-7-9-5-3-2-4-6-10(9)11(13)12(8)14/h7,14H,2-6H2,1H3 |
| InChIKey | ROAFCFKAWPBUPR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|