C10H12ClNO — CID 70563386
8-chloro-2,3,4,5-tetrahydro-1H-2-benzazepin-9-ol (PubChem CID 70563386) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 8-chloro-2,3,4,5-tetrahydro-1H-2-benzazepin-9-ol.
| Compound Name | 8-chloro-2,3,4,5-tetrahydro-1H-2-benzazepin-9-ol |
|---|---|
| PubChem CID | 70563386 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 8-chloro-2,3,4,5-tetrahydro-1H-2-benzazepin-9-ol |
| SMILES | Oc1c(Cl)ccc2c1CNCCC2 |
| InChI | InChI=1S/C10H12ClNO/c11-9-4-3-7-2-1-5-12-6-8(7)10(9)13/h3-4,12-13H,1-2,5-6H2 |
| InChIKey | FKISTRDJOVQCGV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|