About 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one
3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one (PubChem CID 705635) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one |
| PubChem CID | 705635 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one |
| SMILES | COc1ccc(-c2n[nH]c3c2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-16(2)8-12-14(13(19)9-16)15(18-17-12)10-4-6-11(20-3)7-5-10/h4-7H,8-9H2,1-3H3,(H,17,18) |
| InChIKey | MDJWVWVIIJJUKE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one?
The IUPAC name of 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one (CID 705635) is 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one.
What is the SMILES notation for 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one?
The canonical SMILES for 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one is COc1ccc(-c2n[nH]c3c2C(=O)CC(C)(C)C3)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one?
The InChIKey is MDJWVWVIIJJUKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-16(2)8-12-14(13(19)9-16)15(18-17-12)10-4-6-11(20-3)7-5-10/h4-7H,8-9H2,1-3H3,(H,17,18).
What are the key properties of 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one?
3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one has a molecular weight of 270.33 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-6,6-dimethyl-5,7-dihydro-1H-indazol-4-one is sourced from PubChem (CID 705635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).