About N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide
N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide (PubChem CID 70564119) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide |
| PubChem CID | 70564119 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(C)=O)c1c(C)ccc(O)c1C |
| InChI | InChI=1S/C13H17NO2/c1-5-8-14(11(4)15)13-9(2)6-7-12(16)10(13)3/h5-7,16H,1,8H2,2-4H3 |
| InChIKey | HNOHOMKBZGOVPG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide?
The IUPAC name of N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide (CID 70564119) is N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide.
What is the SMILES notation for N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide?
The canonical SMILES for N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide is C=CCN(C(C)=O)c1c(C)ccc(O)c1C.
What is the InChIKey of N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide?
The InChIKey is HNOHOMKBZGOVPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-5-8-14(11(4)15)13-9(2)6-7-12(16)10(13)3/h5-7,16H,1,8H2,2-4H3.
What are the key properties of N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide?
N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide has a molecular weight of 219.28 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-2,6-dimethylphenyl)-N-prop-2-enylacetamide is sourced from PubChem (CID 70564119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).