About 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol
6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol (PubChem CID 70564327) has the molecular formula C17H17FN2O
and a molecular weight of 284.33 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol.
Molecular Properties
| Compound Name | 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol |
| PubChem CID | 70564327 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol |
| SMILES | CN1CC(O)C/N=C(/c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C17H17FN2O/c1-20-11-12(21)10-19-17(13-6-2-4-8-15(13)18)14-7-3-5-9-16(14)20/h2-9,12,21H,10-11H2,1H3/b19-17- |
| InChIKey | UELJWWVTLKRTFY-ZPHPHTNESA-N |
| XLogP | 2.47 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol?
The IUPAC name of 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol (CID 70564327) is 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol.
What is the SMILES notation for 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol?
The canonical SMILES for 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol is CN1CC(O)C/N=C(/c2ccccc2F)c2ccccc21.
What is the InChIKey of 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol?
The InChIKey is UELJWWVTLKRTFY-ZPHPHTNESA-N. The full InChI is InChI=1S/C17H17FN2O/c1-20-11-12(21)10-19-17(13-6-2-4-8-15(13)18)14-7-3-5-9-16(14)20/h2-9,12,21H,10-11H2,1H3/b19-17-.
What are the key properties of 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol?
6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol has a molecular weight of 284.33 g/mol, XLogP of 2.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocin-3-ol is sourced from PubChem (CID 70564327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).