About dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate
dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate (PubChem CID 70564360) has the molecular formula C16H9K2NO5
and a molecular weight of 373.45 g/mol. Its IUPAC name is dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate.
Molecular Properties
| Compound Name | dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate |
| PubChem CID | 70564360 |
| Molecular Formula | C16H9K2NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate |
| SMILES | Cn1c2ccc(C(=O)[O-])c(=O)c-2cc2cc(C(=O)[O-])ccc21.[K+].[K+] |
| InChI | InChI=1S/C16H11NO5.2K/c1-17-12-4-2-8(15(19)20)6-9(12)7-11-13(17)5-3-10(14(11)18)16(21)22;;/h2-7H,1H3,(H,19,20)(H,21,22);;/q;2*+1/p-2 |
| InChIKey | DIXMDHLNRKNOBH-UHFFFAOYSA-L |
| XLogP | -6.62 |
| TPSA | 102.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate?
The IUPAC name of dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate (CID 70564360) is dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate.
What is the SMILES notation for dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate?
The canonical SMILES for dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate is Cn1c2ccc(C(=O)[O-])c(=O)c-2cc2cc(C(=O)[O-])ccc21.[K+].[K+].
What is the InChIKey of dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate?
The InChIKey is DIXMDHLNRKNOBH-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H11NO5.2K/c1-17-12-4-2-8(15(19)20)6-9(12)7-11-13(17)5-3-10(14(11)18)16(21)22;;/h2-7H,1H3,(H,19,20)(H,21,22);;/q;2*+1/p-2.
What are the key properties of dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate?
dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate has a molecular weight of 373.45 g/mol, XLogP of -6.62, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;10-methyl-1-oxoacridine-2,7-dicarboxylate is sourced from PubChem (CID 70564360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).