C14H12ClF3N2O4S2 — CID 70564487
2-[4-amino-5-chloro-2-(trifluoromethyl)phenyl]sulfonyl-6-methylbenzenesulfonamide (PubChem CID 70564487) has the molecular formula C14H12ClF3N2O4S2 and a molecular weight of 428.84 g/mol. Its IUPAC name is 2-[4-amino-5-chloro-2-(trifluoromethyl)phenyl]sulfonyl-6-methylbenzenesulfonamide.
| Compound Name | 2-[4-amino-5-chloro-2-(trifluoromethyl)phenyl]sulfonyl-6-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 70564487 |
| Molecular Formula | C14H12ClF3N2O4S2 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 2-[4-amino-5-chloro-2-(trifluoromethyl)phenyl]sulfonyl-6-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)c2cc(Cl)c(N)cc2C(F)(F)F)c1S(N)(=O)=O |
| InChI | InChI=1S/C14H12ClF3N2O4S2/c1-7-3-2-4-11(13(7)26(20,23)24)25(21,22)12-6-9(15)10(19)5-8(12)14(16,17)18/h2-6H,19H2,1H3,(H2,20,23,24) |
| InChIKey | DANNZSYTZIXYPH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|