C21H24ClFN2O2S — CID 70564766
N-[1-[3-(4-chlorophenyl)-6-fluorohexan-3-yl]indol-4-yl]methanesulfonamide (PubChem CID 70564766) has the molecular formula C21H24ClFN2O2S and a molecular weight of 422.95 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenyl)-6-fluorohexan-3-yl]indol-4-yl]methanesulfonamide.
| Compound Name | N-[1-[3-(4-chlorophenyl)-6-fluorohexan-3-yl]indol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 70564766 |
| Molecular Formula | C21H24ClFN2O2S |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[1-[3-(4-chlorophenyl)-6-fluorohexan-3-yl]indol-4-yl]methanesulfonamide |
| SMILES | CCC(CCCF)(c1ccc(Cl)cc1)n1ccc2c(NS(C)(=O)=O)cccc21 |
| InChI | InChI=1S/C21H24ClFN2O2S/c1-3-21(13-5-14-23,16-8-10-17(22)11-9-16)25-15-12-18-19(24-28(2,26)27)6-4-7-20(18)25/h4,6-12,15,24H,3,5,13-14H2,1-2H3 |
| InChIKey | WNOLSDUCSUTFLR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |